About carbonic acid;ethyl 2-ethylhexanoate
carbonic acid;ethyl 2-ethylhexanoate (PubChem CID 175024500) has the molecular formula C11H22O5
and a molecular weight of 234.29 g/mol. Its IUPAC name is carbonic acid;ethyl 2-ethylhexanoate.
Molecular Properties
| Compound Name | carbonic acid;ethyl 2-ethylhexanoate |
| PubChem CID | 175024500 |
| Molecular Formula | C11H22O5 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | carbonic acid;ethyl 2-ethylhexanoate |
| SMILES | CCCCC(CC)C(=O)OCC.O=C(O)O |
| InChI | InChI=1S/C10H20O2.CH2O3/c1-4-7-8-9(5-2)10(11)12-6-3;2-1(3)4/h9H,4-8H2,1-3H3;(H2,2,3,4) |
| InChIKey | CWJCWOSQMQTMIP-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze carbonic acid;ethyl 2-ethylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbonic acid;ethyl 2-ethylhexanoate?
The IUPAC name of carbonic acid;ethyl 2-ethylhexanoate (CID 175024500) is carbonic acid;ethyl 2-ethylhexanoate.
What is the SMILES notation for carbonic acid;ethyl 2-ethylhexanoate?
The canonical SMILES for carbonic acid;ethyl 2-ethylhexanoate is CCCCC(CC)C(=O)OCC.O=C(O)O.
What is the InChIKey of carbonic acid;ethyl 2-ethylhexanoate?
The InChIKey is CWJCWOSQMQTMIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O2.CH2O3/c1-4-7-8-9(5-2)10(11)12-6-3;2-1(3)4/h9H,4-8H2,1-3H3;(H2,2,3,4).
What are the key properties of carbonic acid;ethyl 2-ethylhexanoate?
carbonic acid;ethyl 2-ethylhexanoate has a molecular weight of 234.29 g/mol, XLogP of 2.99, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbonic acid;ethyl 2-ethylhexanoate is sourced from PubChem (CID 175024500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).