C13H26O — CID 115785527
3,5-diethylnonan-4-one (PubChem CID 115785527) has the molecular formula C13H26O and a molecular weight of 198.35 g/mol. Its IUPAC name is 3,5-diethylnonan-4-one.
| Compound Name | 3,5-diethylnonan-4-one |
|---|---|
| PubChem CID | 115785527 |
| Molecular Formula | C13H26O |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.20 |
| IUPAC Name | 3,5-diethylnonan-4-one |
| SMILES | CCCCC(CC)C(=O)C(CC)CC |
| InChI | InChI=1S/C13H26O/c1-5-9-10-12(8-4)13(14)11(6-2)7-3/h11-12H,5-10H2,1-4H3 |
| InChIKey | KJDJDQMLCIDKCL-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |