About 2-nonan-2-ylpropanedioyl dichloride
2-nonan-2-ylpropanedioyl dichloride (PubChem CID 22468236) has the molecular formula C12H20Cl2O2
and a molecular weight of 267.20 g/mol. Its IUPAC name is 2-nonan-2-ylpropanedioyl dichloride.
Molecular Properties
| Compound Name | 2-nonan-2-ylpropanedioyl dichloride |
| PubChem CID | 22468236 |
| Molecular Formula | C12H20Cl2O2 |
| Molecular Weight | 267.20 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 2-nonan-2-ylpropanedioyl dichloride |
| SMILES | CCCCCCCC(C)C(C(=O)Cl)C(=O)Cl |
| InChI | InChI=1S/C12H20Cl2O2/c1-3-4-5-6-7-8-9(2)10(11(13)15)12(14)16/h9-10H,3-8H2,1-2H3 |
| InChIKey | GIAQGPNFIBEFGS-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.20 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-nonan-2-ylpropanedioyl dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nonan-2-ylpropanedioyl dichloride?
The IUPAC name of 2-nonan-2-ylpropanedioyl dichloride (CID 22468236) is 2-nonan-2-ylpropanedioyl dichloride.
What is the SMILES notation for 2-nonan-2-ylpropanedioyl dichloride?
The canonical SMILES for 2-nonan-2-ylpropanedioyl dichloride is CCCCCCCC(C)C(C(=O)Cl)C(=O)Cl.
What is the InChIKey of 2-nonan-2-ylpropanedioyl dichloride?
The InChIKey is GIAQGPNFIBEFGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20Cl2O2/c1-3-4-5-6-7-8-9(2)10(11(13)15)12(14)16/h9-10H,3-8H2,1-2H3.
What are the key properties of 2-nonan-2-ylpropanedioyl dichloride?
2-nonan-2-ylpropanedioyl dichloride has a molecular weight of 267.20 g/mol, XLogP of 4.13, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nonan-2-ylpropanedioyl dichloride is sourced from PubChem (CID 22468236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).