C8H10BrCl3O — CID 162921656
(4R)-1-bromo-1,2,4-trichlorooct-1-en-3-one (PubChem CID 162921656) has the molecular formula C8H10BrCl3O and a molecular weight of 308.43 g/mol. Its IUPAC name is (4R)-1-bromo-1,2,4-trichlorooct-1-en-3-one.
| Compound Name | (4R)-1-bromo-1,2,4-trichlorooct-1-en-3-one |
|---|---|
| PubChem CID | 162921656 |
| Molecular Formula | C8H10BrCl3O |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 305.90 |
| IUPAC Name | (4R)-1-bromo-1,2,4-trichlorooct-1-en-3-one |
| SMILES | CCCC[C@@H](Cl)C(=O)C(Cl)=C(Cl)Br |
| InChI | InChI=1S/C8H10BrCl3O/c1-2-3-4-5(10)7(13)6(11)8(9)12/h5H,2-4H2,1H3/t5-/m1/s1 |
| InChIKey | PPVKEUQLUHYWNS-RXMQYKEDSA-N |
| XLogP | 4.39 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|