C8H13Cl3 — CID 174758943
1,3,4-trichlorooct-2-ene (PubChem CID 174758943) has the molecular formula C8H13Cl3 and a molecular weight of 215.55 g/mol. Its IUPAC name is 1,3,4-trichlorooct-2-ene.
| Compound Name | 1,3,4-trichlorooct-2-ene |
|---|---|
| PubChem CID | 174758943 |
| Molecular Formula | C8H13Cl3 |
| Molecular Weight | 215.55 g/mol |
| Exact Mass | 214.01 |
| IUPAC Name | 1,3,4-trichlorooct-2-ene |
| SMILES | CCCCC(Cl)C(Cl)=CCCl |
| InChI | InChI=1S/C8H13Cl3/c1-2-3-4-7(10)8(11)5-6-9/h5,7H,2-4,6H2,1H3 |
| InChIKey | SWSLFHKILXUVLN-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.55 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|