About 1,1-dichloropentane;gallane
1,1-dichloropentane;gallane (PubChem CID 174452216) has the molecular formula C5H13Cl2Ga
and a molecular weight of 213.79 g/mol. Its IUPAC name is 1,1-dichloropentane;gallane.
Molecular Properties
| Compound Name | 1,1-dichloropentane;gallane |
| PubChem CID | 174452216 |
| Molecular Formula | C5H13Cl2Ga |
| Molecular Weight | 213.79 g/mol |
| Exact Mass | 211.97 |
| IUPAC Name | 1,1-dichloropentane;gallane |
| SMILES | CCCCC(Cl)Cl.[GaH3] |
| InChI | InChI=1S/C5H10Cl2.Ga.3H/c1-2-3-4-5(6)7;;;;/h5H,2-4H2,1H3;;;; |
| InChIKey | GGFCFELHSAVHKX-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.79 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dichloropentane;gallane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dichloropentane;gallane?
The IUPAC name of 1,1-dichloropentane;gallane (CID 174452216) is 1,1-dichloropentane;gallane.
What is the SMILES notation for 1,1-dichloropentane;gallane?
The canonical SMILES for 1,1-dichloropentane;gallane is CCCCC(Cl)Cl.[GaH3].
What is the InChIKey of 1,1-dichloropentane;gallane?
The InChIKey is GGFCFELHSAVHKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10Cl2.Ga.3H/c1-2-3-4-5(6)7;;;;/h5H,2-4H2,1H3;;;;.
What are the key properties of 1,1-dichloropentane;gallane?
1,1-dichloropentane;gallane has a molecular weight of 213.79 g/mol, XLogP of 1.80, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dichloropentane;gallane is sourced from PubChem (CID 174452216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).