C6H10Cl4 — CID 87407260
1,1,6,6-tetrachlorohexane (PubChem CID 87407260) has the molecular formula C6H10Cl4 and a molecular weight of 223.96 g/mol. Its IUPAC name is 1,1,6,6-tetrachlorohexane.
| Compound Name | 1,1,6,6-tetrachlorohexane |
|---|---|
| PubChem CID | 87407260 |
| Molecular Formula | C6H10Cl4 |
| Molecular Weight | 223.96 g/mol |
| Exact Mass | 221.95 |
| IUPAC Name | 1,1,6,6-tetrachlorohexane |
| SMILES | ClC(Cl)CCCCC(Cl)Cl |
| InChI | InChI=1S/C6H10Cl4/c7-5(8)3-1-2-4-6(9)10/h5-6H,1-4H2 |
| InChIKey | ACSNWXUMKJZXIB-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.96 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|