C8H16Cl2O2 — CID 18674567
2-(5,5-dichloropentyl)propane-1,3-diol (PubChem CID 18674567) has the molecular formula C8H16Cl2O2 and a molecular weight of 215.12 g/mol. Its IUPAC name is 2-(5,5-dichloropentyl)propane-1,3-diol.
| Compound Name | 2-(5,5-dichloropentyl)propane-1,3-diol |
|---|---|
| PubChem CID | 18674567 |
| Molecular Formula | C8H16Cl2O2 |
| Molecular Weight | 215.12 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | 2-(5,5-dichloropentyl)propane-1,3-diol |
| SMILES | OCC(CO)CCCCC(Cl)Cl |
| InChI | InChI=1S/C8H16Cl2O2/c9-8(10)4-2-1-3-7(5-11)6-12/h7-8,11-12H,1-6H2 |
| InChIKey | HUNWIMGUTGHXPL-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.12 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|