About butan-1-ol;1,1-dichloroheptane
butan-1-ol;1,1-dichloroheptane (PubChem CID 88631006) has the molecular formula C11H24Cl2O
and a molecular weight of 243.22 g/mol. Its IUPAC name is butan-1-ol;1,1-dichloroheptane.
Molecular Properties
| Compound Name | butan-1-ol;1,1-dichloroheptane |
| PubChem CID | 88631006 |
| Molecular Formula | C11H24Cl2O |
| Molecular Weight | 243.22 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | butan-1-ol;1,1-dichloroheptane |
| SMILES | CCCCCCC(Cl)Cl.CCCCO |
| InChI | InChI=1S/C7H14Cl2.C4H10O/c1-2-3-4-5-6-7(8)9;1-2-3-4-5/h7H,2-6H2,1H3;5H,2-4H2,1H3 |
| InChIKey | UIPXZDCKDQZXPY-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.22 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze butan-1-ol;1,1-dichloroheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-1-ol;1,1-dichloroheptane?
The IUPAC name of butan-1-ol;1,1-dichloroheptane (CID 88631006) is butan-1-ol;1,1-dichloroheptane.
What is the SMILES notation for butan-1-ol;1,1-dichloroheptane?
The canonical SMILES for butan-1-ol;1,1-dichloroheptane is CCCCCCC(Cl)Cl.CCCCO.
What is the InChIKey of butan-1-ol;1,1-dichloroheptane?
The InChIKey is UIPXZDCKDQZXPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14Cl2.C4H10O/c1-2-3-4-5-6-7(8)9;1-2-3-4-5/h7H,2-6H2,1H3;5H,2-4H2,1H3.
What are the key properties of butan-1-ol;1,1-dichloroheptane?
butan-1-ol;1,1-dichloroheptane has a molecular weight of 243.22 g/mol, XLogP of 4.54, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butan-1-ol;1,1-dichloroheptane is sourced from PubChem (CID 88631006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).