About 19,19-dichlorononadec-1-yne
19,19-dichlorononadec-1-yne (PubChem CID 88635184) has the molecular formula C19H34Cl2
and a molecular weight of 333.39 g/mol. Its IUPAC name is 19,19-dichlorononadec-1-yne.
Molecular Properties
| Compound Name | 19,19-dichlorononadec-1-yne |
| PubChem CID | 88635184 |
| Molecular Formula | C19H34Cl2 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | 19,19-dichlorononadec-1-yne |
| SMILES | C#CCCCCCCCCCCCCCCCCC(Cl)Cl |
| InChI | InChI=1S/C19H34Cl2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21/h1,19H,3-18H2 |
| InChIKey | BFZFLIUDFVRARV-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 19,19-dichlorononadec-1-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 19,19-dichlorononadec-1-yne?
The IUPAC name of 19,19-dichlorononadec-1-yne (CID 88635184) is 19,19-dichlorononadec-1-yne.
What is the SMILES notation for 19,19-dichlorononadec-1-yne?
The canonical SMILES for 19,19-dichlorononadec-1-yne is C#CCCCCCCCCCCCCCCCCC(Cl)Cl.
What is the InChIKey of 19,19-dichlorononadec-1-yne?
The InChIKey is BFZFLIUDFVRARV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H34Cl2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21/h1,19H,3-18H2.
What are the key properties of 19,19-dichlorononadec-1-yne?
19,19-dichlorononadec-1-yne has a molecular weight of 333.39 g/mol, XLogP of 7.66, 16 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 19,19-dichlorononadec-1-yne is sourced from PubChem (CID 88635184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).