About dec-9-yn-4-amine
dec-9-yn-4-amine (PubChem CID 64505072) has the molecular formula C10H19N
and a molecular weight of 153.27 g/mol. Its IUPAC name is dec-9-yn-4-amine.
Molecular Properties
| Compound Name | dec-9-yn-4-amine |
| PubChem CID | 64505072 |
| Molecular Formula | C10H19N |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.15 |
| IUPAC Name | dec-9-yn-4-amine |
| SMILES | C#CCCCCC(N)CCC |
| InChI | InChI=1S/C10H19N/c1-3-5-6-7-9-10(11)8-4-2/h1,10H,4-9,11H2,2H3 |
| InChIKey | IPBGVJYNMTUCCA-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze dec-9-yn-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dec-9-yn-4-amine?
The IUPAC name of dec-9-yn-4-amine (CID 64505072) is dec-9-yn-4-amine.
What is the SMILES notation for dec-9-yn-4-amine?
The canonical SMILES for dec-9-yn-4-amine is C#CCCCCC(N)CCC.
What is the InChIKey of dec-9-yn-4-amine?
The InChIKey is IPBGVJYNMTUCCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N/c1-3-5-6-7-9-10(11)8-4-2/h1,10H,4-9,11H2,2H3.
What are the key properties of dec-9-yn-4-amine?
dec-9-yn-4-amine has a molecular weight of 153.27 g/mol, XLogP of 2.31, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dec-9-yn-4-amine is sourced from PubChem (CID 64505072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).