C5H10Cl3N — CID 57159022
1,5,5-trichloropentan-1-amine (PubChem CID 57159022) has the molecular formula C5H10Cl3N and a molecular weight of 190.50 g/mol. Its IUPAC name is 1,5,5-trichloropentan-1-amine.
| Compound Name | 1,5,5-trichloropentan-1-amine |
|---|---|
| PubChem CID | 57159022 |
| Molecular Formula | C5H10Cl3N |
| Molecular Weight | 190.50 g/mol |
| Exact Mass | 188.99 |
| IUPAC Name | 1,5,5-trichloropentan-1-amine |
| SMILES | NC(Cl)CCCC(Cl)Cl |
| InChI | InChI=1S/C5H10Cl3N/c6-4(7)2-1-3-5(8)9/h4-5H,1-3,9H2 |
| InChIKey | MANZHHRSJHEPDV-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.50 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|