About 1-chlorodocosan-1-amine
1-chlorodocosan-1-amine (PubChem CID 174773966) has the molecular formula C22H46ClN
and a molecular weight of 360.07 g/mol. Its IUPAC name is 1-chlorodocosan-1-amine.
Molecular Properties
| Compound Name | 1-chlorodocosan-1-amine |
| PubChem CID | 174773966 |
| Molecular Formula | C22H46ClN |
| Molecular Weight | 360.07 g/mol |
| Exact Mass | 359.33 |
| IUPAC Name | 1-chlorodocosan-1-amine |
| SMILES | CCCCCCCCCCCCCCCCCCCCCC(N)Cl |
| InChI | InChI=1S/C22H46ClN/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24/h22H,2-21,24H2,1H3 |
| InChIKey | LFLUBJQFBBXWTO-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.07 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-chlorodocosan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chlorodocosan-1-amine?
The IUPAC name of 1-chlorodocosan-1-amine (CID 174773966) is 1-chlorodocosan-1-amine.
What is the SMILES notation for 1-chlorodocosan-1-amine?
The canonical SMILES for 1-chlorodocosan-1-amine is CCCCCCCCCCCCCCCCCCCCCC(N)Cl.
What is the InChIKey of 1-chlorodocosan-1-amine?
The InChIKey is LFLUBJQFBBXWTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H46ClN/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24/h22H,2-21,24H2,1H3.
What are the key properties of 1-chlorodocosan-1-amine?
1-chlorodocosan-1-amine has a molecular weight of 360.07 g/mol, XLogP of 8.33, 20 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chlorodocosan-1-amine is sourced from PubChem (CID 174773966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).