About 1-chlorohexane-1,2-diamine
1-chlorohexane-1,2-diamine (PubChem CID 151875829) has the molecular formula C6H15ClN2
and a molecular weight of 150.65 g/mol. Its IUPAC name is 1-chlorohexane-1,2-diamine.
Molecular Properties
| Compound Name | 1-chlorohexane-1,2-diamine |
| PubChem CID | 151875829 |
| Molecular Formula | C6H15ClN2 |
| Molecular Weight | 150.65 g/mol |
| Exact Mass | 150.09 |
| IUPAC Name | 1-chlorohexane-1,2-diamine |
| SMILES | CCCCC(N)C(N)Cl |
| InChI | InChI=1S/C6H15ClN2/c1-2-3-4-5(8)6(7)9/h5-6H,2-4,8-9H2,1H3 |
| InChIKey | SNQRGYHRXNXQHO-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.65 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-chlorohexane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chlorohexane-1,2-diamine?
The IUPAC name of 1-chlorohexane-1,2-diamine (CID 151875829) is 1-chlorohexane-1,2-diamine.
What is the SMILES notation for 1-chlorohexane-1,2-diamine?
The canonical SMILES for 1-chlorohexane-1,2-diamine is CCCCC(N)C(N)Cl.
What is the InChIKey of 1-chlorohexane-1,2-diamine?
The InChIKey is SNQRGYHRXNXQHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15ClN2/c1-2-3-4-5(8)6(7)9/h5-6H,2-4,8-9H2,1H3.
What are the key properties of 1-chlorohexane-1,2-diamine?
1-chlorohexane-1,2-diamine has a molecular weight of 150.65 g/mol, XLogP of 1.03, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chlorohexane-1,2-diamine is sourced from PubChem (CID 151875829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).