C7H18N2O — CID 23346836
1,3-diaminoheptan-2-ol (PubChem CID 23346836) has the molecular formula C7H18N2O and a molecular weight of 146.23 g/mol. Its IUPAC name is 1,3-diaminoheptan-2-ol.
| Compound Name | 1,3-diaminoheptan-2-ol |
|---|---|
| PubChem CID | 23346836 |
| Molecular Formula | C7H18N2O |
| Molecular Weight | 146.23 g/mol |
| Exact Mass | 146.14 |
| IUPAC Name | 1,3-diaminoheptan-2-ol |
| SMILES | CCCCC(N)C(O)CN |
| InChI | InChI=1S/C7H18N2O/c1-2-3-4-6(9)7(10)5-8/h6-7,10H,2-5,8-9H2,1H3 |
| InChIKey | ANHNHADOAOTGNS-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.23 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |