About (2S)-2-aminoheptane-1,1-diol
(2S)-2-aminoheptane-1,1-diol (PubChem CID 166719915) has the molecular formula C7H17NO2
and a molecular weight of 147.22 g/mol. Its IUPAC name is (2S)-2-aminoheptane-1,1-diol.
Molecular Properties
| Compound Name | (2S)-2-aminoheptane-1,1-diol |
| PubChem CID | 166719915 |
| Molecular Formula | C7H17NO2 |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.13 |
| IUPAC Name | (2S)-2-aminoheptane-1,1-diol |
| SMILES | CCCCC[C@H](N)C(O)O |
| InChI | InChI=1S/C7H17NO2/c1-2-3-4-5-6(8)7(9)10/h6-7,9-10H,2-5,8H2,1H3/t6-/m0/s1 |
| InChIKey | FYASOEGFKYRYRY-LURJTMIESA-N |
| XLogP | 0.20 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-aminoheptane-1,1-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-aminoheptane-1,1-diol?
The IUPAC name of (2S)-2-aminoheptane-1,1-diol (CID 166719915) is (2S)-2-aminoheptane-1,1-diol.
What is the SMILES notation for (2S)-2-aminoheptane-1,1-diol?
The canonical SMILES for (2S)-2-aminoheptane-1,1-diol is CCCCC[C@H](N)C(O)O.
What is the InChIKey of (2S)-2-aminoheptane-1,1-diol?
The InChIKey is FYASOEGFKYRYRY-LURJTMIESA-N. The full InChI is InChI=1S/C7H17NO2/c1-2-3-4-5-6(8)7(9)10/h6-7,9-10H,2-5,8H2,1H3/t6-/m0/s1.
What are the key properties of (2S)-2-aminoheptane-1,1-diol?
(2S)-2-aminoheptane-1,1-diol has a molecular weight of 147.22 g/mol, XLogP of 0.20, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-aminoheptane-1,1-diol is sourced from PubChem (CID 166719915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).