About 3-aminooctan-2-ol
3-aminooctan-2-ol (PubChem CID 14271184) has the molecular formula C8H19NO
and a molecular weight of 145.25 g/mol. Its IUPAC name is 3-aminooctan-2-ol.
Molecular Properties
| Compound Name | 3-aminooctan-2-ol |
| PubChem CID | 14271184 |
| Molecular Formula | C8H19NO |
| Molecular Weight | 145.25 g/mol |
| Exact Mass | 145.15 |
| IUPAC Name | 3-aminooctan-2-ol |
| SMILES | CCCCCC(N)C(C)O |
| InChI | InChI=1S/C8H19NO/c1-3-4-5-6-8(9)7(2)10/h7-8,10H,3-6,9H2,1-2H3 |
| InChIKey | ZSPFVQUYVKGZEN-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.25 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-aminooctan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminooctan-2-ol?
The IUPAC name of 3-aminooctan-2-ol (CID 14271184) is 3-aminooctan-2-ol.
What is the SMILES notation for 3-aminooctan-2-ol?
The canonical SMILES for 3-aminooctan-2-ol is CCCCCC(N)C(C)O.
What is the InChIKey of 3-aminooctan-2-ol?
The InChIKey is ZSPFVQUYVKGZEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19NO/c1-3-4-5-6-8(9)7(2)10/h7-8,10H,3-6,9H2,1-2H3.
What are the key properties of 3-aminooctan-2-ol?
3-aminooctan-2-ol has a molecular weight of 145.25 g/mol, XLogP of 1.27, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminooctan-2-ol is sourced from PubChem (CID 14271184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).