About 3-aminoicosan-2-ol
3-aminoicosan-2-ol (PubChem CID 19964089) has the molecular formula C20H43NO
and a molecular weight of 313.57 g/mol. Its IUPAC name is 3-aminoicosan-2-ol.
Molecular Properties
| Compound Name | 3-aminoicosan-2-ol |
| PubChem CID | 19964089 |
| Molecular Formula | C20H43NO |
| Molecular Weight | 313.57 g/mol |
| Exact Mass | 313.33 |
| IUPAC Name | 3-aminoicosan-2-ol |
| SMILES | CCCCCCCCCCCCCCCCCC(N)C(C)O |
| InChI | InChI=1S/C20H43NO/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20(21)19(2)22/h19-20,22H,3-18,21H2,1-2H3 |
| InChIKey | SXJGRQUVPAGPNK-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 313.57 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-aminoicosan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminoicosan-2-ol?
The IUPAC name of 3-aminoicosan-2-ol (CID 19964089) is 3-aminoicosan-2-ol.
What is the SMILES notation for 3-aminoicosan-2-ol?
The canonical SMILES for 3-aminoicosan-2-ol is CCCCCCCCCCCCCCCCCC(N)C(C)O.
What is the InChIKey of 3-aminoicosan-2-ol?
The InChIKey is SXJGRQUVPAGPNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H43NO/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20(21)19(2)22/h19-20,22H,3-18,21H2,1-2H3.
What are the key properties of 3-aminoicosan-2-ol?
3-aminoicosan-2-ol has a molecular weight of 313.57 g/mol, XLogP of 5.96, 17 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminoicosan-2-ol is sourced from PubChem (CID 19964089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).