About 2-aminononadecane-1,1-diol;hydrobromide
2-aminononadecane-1,1-diol;hydrobromide (PubChem CID 175114917) has the molecular formula C19H42BrNO2
and a molecular weight of 396.45 g/mol. Its IUPAC name is 2-aminononadecane-1,1-diol;hydrobromide.
Molecular Properties
| Compound Name | 2-aminononadecane-1,1-diol;hydrobromide |
| PubChem CID | 175114917 |
| Molecular Formula | C19H42BrNO2 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 395.24 |
| IUPAC Name | 2-aminononadecane-1,1-diol;hydrobromide |
| SMILES | Br.CCCCCCCCCCCCCCCCCC(N)C(O)O |
| InChI | InChI=1S/C19H41NO2.BrH/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(20)19(21)22;/h18-19,21-22H,2-17,20H2,1H3;1H |
| InChIKey | GLDIYVGDKPRBEN-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-aminononadecane-1,1-diol;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminononadecane-1,1-diol;hydrobromide?
The IUPAC name of 2-aminononadecane-1,1-diol;hydrobromide (CID 175114917) is 2-aminononadecane-1,1-diol;hydrobromide.
What is the SMILES notation for 2-aminononadecane-1,1-diol;hydrobromide?
The canonical SMILES for 2-aminononadecane-1,1-diol;hydrobromide is Br.CCCCCCCCCCCCCCCCCC(N)C(O)O.
What is the InChIKey of 2-aminononadecane-1,1-diol;hydrobromide?
The InChIKey is GLDIYVGDKPRBEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H41NO2.BrH/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(20)19(21)22;/h18-19,21-22H,2-17,20H2,1H3;1H.
What are the key properties of 2-aminononadecane-1,1-diol;hydrobromide?
2-aminononadecane-1,1-diol;hydrobromide has a molecular weight of 396.45 g/mol, XLogP of 5.46, 17 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminononadecane-1,1-diol;hydrobromide is sourced from PubChem (CID 175114917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).