About 1-aminohexadecan-1-ol
1-aminohexadecan-1-ol (PubChem CID 21475561) has the molecular formula C16H35NO
and a molecular weight of 257.46 g/mol. Its IUPAC name is 1-aminohexadecan-1-ol.
Molecular Properties
| Compound Name | 1-aminohexadecan-1-ol |
| PubChem CID | 21475561 |
| Molecular Formula | C16H35NO |
| Molecular Weight | 257.46 g/mol |
| Exact Mass | 257.27 |
| IUPAC Name | 1-aminohexadecan-1-ol |
| SMILES | CCCCCCCCCCCCCCCC(N)O |
| InChI | InChI=1S/C16H35NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h16,18H,2-15,17H2,1H3 |
| InChIKey | RFVAVVBAYBKZHG-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.46 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-aminohexadecan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminohexadecan-1-ol?
The IUPAC name of 1-aminohexadecan-1-ol (CID 21475561) is 1-aminohexadecan-1-ol.
What is the SMILES notation for 1-aminohexadecan-1-ol?
The canonical SMILES for 1-aminohexadecan-1-ol is CCCCCCCCCCCCCCCC(N)O.
What is the InChIKey of 1-aminohexadecan-1-ol?
The InChIKey is RFVAVVBAYBKZHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H35NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h16,18H,2-15,17H2,1H3.
What are the key properties of 1-aminohexadecan-1-ol?
1-aminohexadecan-1-ol has a molecular weight of 257.46 g/mol, XLogP of 4.74, 14 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminohexadecan-1-ol is sourced from PubChem (CID 21475561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).