About hexadecane-4,5-diamine
hexadecane-4,5-diamine (PubChem CID 57310882) has the molecular formula C16H36N2
and a molecular weight of 256.48 g/mol. Its IUPAC name is hexadecane-4,5-diamine.
Molecular Properties
| Compound Name | hexadecane-4,5-diamine |
| PubChem CID | 57310882 |
| Molecular Formula | C16H36N2 |
| Molecular Weight | 256.48 g/mol |
| Exact Mass | 256.29 |
| IUPAC Name | hexadecane-4,5-diamine |
| SMILES | CCCCCCCCCCCC(N)C(N)CCC |
| InChI | InChI=1S/C16H36N2/c1-3-5-6-7-8-9-10-11-12-14-16(18)15(17)13-4-2/h15-16H,3-14,17-18H2,1-2H3 |
| InChIKey | NPKVZXKWIISBOP-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.48 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexadecane-4,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexadecane-4,5-diamine?
The IUPAC name of hexadecane-4,5-diamine (CID 57310882) is hexadecane-4,5-diamine.
What is the SMILES notation for hexadecane-4,5-diamine?
The canonical SMILES for hexadecane-4,5-diamine is CCCCCCCCCCCC(N)C(N)CCC.
What is the InChIKey of hexadecane-4,5-diamine?
The InChIKey is NPKVZXKWIISBOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H36N2/c1-3-5-6-7-8-9-10-11-12-14-16(18)15(17)13-4-2/h15-16H,3-14,17-18H2,1-2H3.
What are the key properties of hexadecane-4,5-diamine?
hexadecane-4,5-diamine has a molecular weight of 256.48 g/mol, XLogP of 4.36, 13 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hexadecane-4,5-diamine is sourced from PubChem (CID 57310882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).