C9H23N3 — CID 140867802
nonane-1,3,4-triamine (PubChem CID 140867802) has the molecular formula C9H23N3 and a molecular weight of 173.30 g/mol. Its IUPAC name is nonane-1,3,4-triamine.
| Compound Name | nonane-1,3,4-triamine |
|---|---|
| PubChem CID | 140867802 |
| Molecular Formula | C9H23N3 |
| Molecular Weight | 173.30 g/mol |
| Exact Mass | 173.19 |
| IUPAC Name | nonane-1,3,4-triamine |
| SMILES | CCCCCC(N)C(N)CCN |
| InChI | InChI=1S/C9H23N3/c1-2-3-4-5-8(11)9(12)6-7-10/h8-9H,2-7,10-12H2,1H3 |
| InChIKey | YQHQWMADNBKNOF-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.30 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|