C23H52F2N2O — CID 88511699
3-(1,3-diaminopropyl)icosan-1-ol;dihydrofluoride (PubChem CID 88511699) has the molecular formula C23H52F2N2O and a molecular weight of 410.68 g/mol. Its IUPAC name is 3-(1,3-diaminopropyl)icosan-1-ol;dihydrofluoride.
| Compound Name | 3-(1,3-diaminopropyl)icosan-1-ol;dihydrofluoride |
|---|---|
| PubChem CID | 88511699 |
| Molecular Formula | C23H52F2N2O |
| Molecular Weight | 410.68 g/mol |
| Exact Mass | 410.40 |
| IUPAC Name | 3-(1,3-diaminopropyl)icosan-1-ol;dihydrofluoride |
| SMILES | CCCCCCCCCCCCCCCCCC(CCO)C(N)CCN.F.F |
| InChI | InChI=1S/C23H50N2O.2FH/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22(19-21-26)23(25)18-20-24;;/h22-23,26H,2-21,24-25H2,1H3;2*1H |
| InChIKey | AEDZDIQHGRUUMK-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.68 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|