C8H20N2 — CID 13138963
(4R,5R)-octane-4,5-diamine (PubChem CID 13138963) has the molecular formula C8H20N2 and a molecular weight of 144.26 g/mol. Its IUPAC name is (4R,5R)-octane-4,5-diamine.
| Compound Name | (4R,5R)-octane-4,5-diamine |
|---|---|
| PubChem CID | 13138963 |
| Molecular Formula | C8H20N2 |
| Molecular Weight | 144.26 g/mol |
| Exact Mass | 144.16 |
| IUPAC Name | (4R,5R)-octane-4,5-diamine |
| SMILES | CCC[C@@H](N)[C@H](N)CCC |
| InChI | InChI=1S/C8H20N2/c1-3-5-7(9)8(10)6-4-2/h7-8H,3-6,9-10H2,1-2H3/t7-,8-/m1/s1 |
| InChIKey | NHOGRGYHBHZMIL-HTQZYQBOSA-N |
| XLogP | 1.24 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.26 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |