About butane-1,1-diamine;platinum
butane-1,1-diamine;platinum (PubChem CID 88509821) has the molecular formula C4H12N2Pt
and a molecular weight of 283.23 g/mol. Its IUPAC name is butane-1,1-diamine;platinum.
Molecular Properties
| Compound Name | butane-1,1-diamine;platinum |
| PubChem CID | 88509821 |
| Molecular Formula | C4H12N2Pt |
| Molecular Weight | 283.23 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | butane-1,1-diamine;platinum |
| SMILES | CCCC(N)N.[Pt] |
| InChI | InChI=1S/C4H12N2.Pt/c1-2-3-4(5)6;/h4H,2-3,5-6H2,1H3; |
| InChIKey | UFMVAXBKGNKETC-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.23 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze butane-1,1-diamine;platinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane-1,1-diamine;platinum?
The IUPAC name of butane-1,1-diamine;platinum (CID 88509821) is butane-1,1-diamine;platinum.
What is the SMILES notation for butane-1,1-diamine;platinum?
The canonical SMILES for butane-1,1-diamine;platinum is CCCC(N)N.[Pt].
What is the InChIKey of butane-1,1-diamine;platinum?
The InChIKey is UFMVAXBKGNKETC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H12N2.Pt/c1-2-3-4(5)6;/h4H,2-3,5-6H2,1H3;.
What are the key properties of butane-1,1-diamine;platinum?
butane-1,1-diamine;platinum has a molecular weight of 283.23 g/mol, XLogP of 0.03, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butane-1,1-diamine;platinum is sourced from PubChem (CID 88509821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).