C20H44N2O2 — CID 87384635
1,1-diaminoicosane-4,17-diol (PubChem CID 87384635) has the molecular formula C20H44N2O2 and a molecular weight of 344.58 g/mol. Its IUPAC name is 1,1-diaminoicosane-4,17-diol.
| Compound Name | 1,1-diaminoicosane-4,17-diol |
|---|---|
| PubChem CID | 87384635 |
| Molecular Formula | C20H44N2O2 |
| Molecular Weight | 344.58 g/mol |
| Exact Mass | 344.34 |
| IUPAC Name | 1,1-diaminoicosane-4,17-diol |
| SMILES | CCCC(O)CCCCCCCCCCCCC(O)CCC(N)N |
| InChI | InChI=1S/C20H44N2O2/c1-2-13-18(23)14-11-9-7-5-3-4-6-8-10-12-15-19(24)16-17-20(21)22/h18-20,23-24H,2-17,21-22H2,1H3 |
| InChIKey | MGIYJDFGAHPLQD-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.58 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|