About 8-aminooctan-4-ol
8-aminooctan-4-ol (PubChem CID 146035755) has the molecular formula C8H19NO
and a molecular weight of 145.25 g/mol. Its IUPAC name is 8-aminooctan-4-ol.
Molecular Properties
| Compound Name | 8-aminooctan-4-ol |
| PubChem CID | 146035755 |
| Molecular Formula | C8H19NO |
| Molecular Weight | 145.25 g/mol |
| Exact Mass | 145.15 |
| IUPAC Name | 8-aminooctan-4-ol |
| SMILES | CCCC(O)CCCCN |
| InChI | InChI=1S/C8H19NO/c1-2-5-8(10)6-3-4-7-9/h8,10H,2-7,9H2,1H3 |
| InChIKey | FGBXVVMARDLGQU-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.25 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-aminooctan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-aminooctan-4-ol?
The IUPAC name of 8-aminooctan-4-ol (CID 146035755) is 8-aminooctan-4-ol.
What is the SMILES notation for 8-aminooctan-4-ol?
The canonical SMILES for 8-aminooctan-4-ol is CCCC(O)CCCCN.
What is the InChIKey of 8-aminooctan-4-ol?
The InChIKey is FGBXVVMARDLGQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19NO/c1-2-5-8(10)6-3-4-7-9/h8,10H,2-7,9H2,1H3.
What are the key properties of 8-aminooctan-4-ol?
8-aminooctan-4-ol has a molecular weight of 145.25 g/mol, XLogP of 1.28, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-aminooctan-4-ol is sourced from PubChem (CID 146035755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).