About 1-aminopentadecan-4-ol
1-aminopentadecan-4-ol (PubChem CID 151480186) has the molecular formula C15H33NO
and a molecular weight of 243.43 g/mol. Its IUPAC name is 1-aminopentadecan-4-ol.
Molecular Properties
| Compound Name | 1-aminopentadecan-4-ol |
| PubChem CID | 151480186 |
| Molecular Formula | C15H33NO |
| Molecular Weight | 243.43 g/mol |
| Exact Mass | 243.26 |
| IUPAC Name | 1-aminopentadecan-4-ol |
| SMILES | CCCCCCCCCCCC(O)CCCN |
| InChI | InChI=1S/C15H33NO/c1-2-3-4-5-6-7-8-9-10-12-15(17)13-11-14-16/h15,17H,2-14,16H2,1H3 |
| InChIKey | PMHOWASITMMWJL-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.43 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-aminopentadecan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminopentadecan-4-ol?
The IUPAC name of 1-aminopentadecan-4-ol (CID 151480186) is 1-aminopentadecan-4-ol.
What is the SMILES notation for 1-aminopentadecan-4-ol?
The canonical SMILES for 1-aminopentadecan-4-ol is CCCCCCCCCCCC(O)CCCN.
What is the InChIKey of 1-aminopentadecan-4-ol?
The InChIKey is PMHOWASITMMWJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H33NO/c1-2-3-4-5-6-7-8-9-10-12-15(17)13-11-14-16/h15,17H,2-14,16H2,1H3.
What are the key properties of 1-aminopentadecan-4-ol?
1-aminopentadecan-4-ol has a molecular weight of 243.43 g/mol, XLogP of 4.01, 13 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminopentadecan-4-ol is sourced from PubChem (CID 151480186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).