About pentan-2-amine;propane
pentan-2-amine;propane (PubChem CID 166536368) has the molecular formula C8H21N
and a molecular weight of 131.26 g/mol. Its IUPAC name is pentan-2-amine;propane.
Molecular Properties
| Compound Name | pentan-2-amine;propane |
| PubChem CID | 166536368 |
| Molecular Formula | C8H21N |
| Molecular Weight | 131.26 g/mol |
| Exact Mass | 131.17 |
| IUPAC Name | pentan-2-amine;propane |
| SMILES | CCC.CCCC(C)N |
| InChI | InChI=1S/C5H13N.C3H8/c1-3-4-5(2)6;1-3-2/h5H,3-4,6H2,1-2H3;3H2,1-2H3 |
| InChIKey | MBQBNHBEBQXVPX-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.26 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze pentan-2-amine;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentan-2-amine;propane?
The IUPAC name of pentan-2-amine;propane (CID 166536368) is pentan-2-amine;propane.
What is the SMILES notation for pentan-2-amine;propane?
The canonical SMILES for pentan-2-amine;propane is CCC.CCCC(C)N.
What is the InChIKey of pentan-2-amine;propane?
The InChIKey is MBQBNHBEBQXVPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13N.C3H8/c1-3-4-5(2)6;1-3-2/h5H,3-4,6H2,1-2H3;3H2,1-2H3.
What are the key properties of pentan-2-amine;propane?
pentan-2-amine;propane has a molecular weight of 131.26 g/mol, XLogP of 2.55, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for pentan-2-amine;propane is sourced from PubChem (CID 166536368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).