About tetradecane-1,1-diamine;dihydrochloride
tetradecane-1,1-diamine;dihydrochloride (PubChem CID 21115936) has the molecular formula C14H34Cl2N2
and a molecular weight of 301.35 g/mol. Its IUPAC name is tetradecane-1,1-diamine;dihydrochloride.
Molecular Properties
| Compound Name | tetradecane-1,1-diamine;dihydrochloride |
| PubChem CID | 21115936 |
| Molecular Formula | C14H34Cl2N2 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | tetradecane-1,1-diamine;dihydrochloride |
| SMILES | CCCCCCCCCCCCCC(N)N.Cl.Cl |
| InChI | InChI=1S/C14H32N2.2ClH/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16;;/h14H,2-13,15-16H2,1H3;2*1H |
| InChIKey | JGJFPWORZWBLCL-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze tetradecane-1,1-diamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetradecane-1,1-diamine;dihydrochloride?
The IUPAC name of tetradecane-1,1-diamine;dihydrochloride (CID 21115936) is tetradecane-1,1-diamine;dihydrochloride.
What is the SMILES notation for tetradecane-1,1-diamine;dihydrochloride?
The canonical SMILES for tetradecane-1,1-diamine;dihydrochloride is CCCCCCCCCCCCCC(N)N.Cl.Cl.
What is the InChIKey of tetradecane-1,1-diamine;dihydrochloride?
The InChIKey is JGJFPWORZWBLCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H32N2.2ClH/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16;;/h14H,2-13,15-16H2,1H3;2*1H.
What are the key properties of tetradecane-1,1-diamine;dihydrochloride?
tetradecane-1,1-diamine;dihydrochloride has a molecular weight of 301.35 g/mol, XLogP of 4.77, 12 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tetradecane-1,1-diamine;dihydrochloride is sourced from PubChem (CID 21115936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).