C8H20N2O — CID 87063615
4,5-diaminooctan-1-ol (PubChem CID 87063615) has the molecular formula C8H20N2O and a molecular weight of 160.26 g/mol. Its IUPAC name is 4,5-diaminooctan-1-ol.
| Compound Name | 4,5-diaminooctan-1-ol |
|---|---|
| PubChem CID | 87063615 |
| Molecular Formula | C8H20N2O |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.16 |
| IUPAC Name | 4,5-diaminooctan-1-ol |
| SMILES | CCCC(N)C(N)CCCO |
| InChI | InChI=1S/C8H20N2O/c1-2-4-7(9)8(10)5-3-6-11/h7-8,11H,2-6,9-10H2,1H3 |
| InChIKey | VFGJJVKMHAGJAC-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |