About 5,7-dimethyloctan-4-amine
5,7-dimethyloctan-4-amine (PubChem CID 83047107) has the molecular formula C10H23N
and a molecular weight of 157.30 g/mol. Its IUPAC name is 5,7-dimethyloctan-4-amine.
Molecular Properties
| Compound Name | 5,7-dimethyloctan-4-amine |
| PubChem CID | 83047107 |
| Molecular Formula | C10H23N |
| Molecular Weight | 157.30 g/mol |
| Exact Mass | 157.18 |
| IUPAC Name | 5,7-dimethyloctan-4-amine |
| SMILES | CCCC(N)C(C)CC(C)C |
| InChI | InChI=1S/C10H23N/c1-5-6-10(11)9(4)7-8(2)3/h8-10H,5-7,11H2,1-4H3 |
| InChIKey | VXPVDDYOMNVBOQ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.30 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5,7-dimethyloctan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dimethyloctan-4-amine?
The IUPAC name of 5,7-dimethyloctan-4-amine (CID 83047107) is 5,7-dimethyloctan-4-amine.
What is the SMILES notation for 5,7-dimethyloctan-4-amine?
The canonical SMILES for 5,7-dimethyloctan-4-amine is CCCC(N)C(C)CC(C)C.
What is the InChIKey of 5,7-dimethyloctan-4-amine?
The InChIKey is VXPVDDYOMNVBOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23N/c1-5-6-10(11)9(4)7-8(2)3/h8-10H,5-7,11H2,1-4H3.
What are the key properties of 5,7-dimethyloctan-4-amine?
5,7-dimethyloctan-4-amine has a molecular weight of 157.30 g/mol, XLogP of 2.80, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dimethyloctan-4-amine is sourced from PubChem (CID 83047107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).