C10H23N — CID 151288694
(3R,4R,5R)-4,5-dimethyloctan-3-amine (PubChem CID 151288694) has the molecular formula C10H23N and a molecular weight of 157.30 g/mol. Its IUPAC name is (3R,4R,5R)-4,5-dimethyloctan-3-amine.
| Compound Name | (3R,4R,5R)-4,5-dimethyloctan-3-amine |
|---|---|
| PubChem CID | 151288694 |
| Molecular Formula | C10H23N |
| Molecular Weight | 157.30 g/mol |
| Exact Mass | 157.18 |
| IUPAC Name | (3R,4R,5R)-4,5-dimethyloctan-3-amine |
| SMILES | CCC[C@@H](C)[C@@H](C)[C@H](N)CC |
| InChI | InChI=1S/C10H23N/c1-5-7-8(3)9(4)10(11)6-2/h8-10H,5-7,11H2,1-4H3/t8-,9-,10-/m1/s1 |
| InChIKey | NZYSVPNESKLFAR-OPRDCNLKSA-N |
| XLogP | 2.80 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.30 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |