C22H46 — CID 123419522
2,3,4,5,6,7,8,9,10-nonamethyltridecane (PubChem CID 123419522) has the molecular formula C22H46 and a molecular weight of 310.61 g/mol. Its IUPAC name is 2,3,4,5,6,7,8,9,10-nonamethyltridecane.
| Compound Name | 2,3,4,5,6,7,8,9,10-nonamethyltridecane |
|---|---|
| PubChem CID | 123419522 |
| Molecular Formula | C22H46 |
| Molecular Weight | 310.61 g/mol |
| Exact Mass | 310.36 |
| IUPAC Name | 2,3,4,5,6,7,8,9,10-nonamethyltridecane |
| SMILES | CCCC(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C |
| InChI | InChI=1S/C22H46/c1-12-13-15(4)17(6)19(8)21(10)22(11)20(9)18(7)16(5)14(2)3/h14-22H,12-13H2,1-11H3 |
| InChIKey | WMBWRBFJJGOTMO-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.61 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |