C24H50 — CID 123746260
4,5,6,7,8,9-hexamethyloctadecane (PubChem CID 123746260) has the molecular formula C24H50 and a molecular weight of 338.66 g/mol. Its IUPAC name is 4,5,6,7,8,9-hexamethyloctadecane.
| Compound Name | 4,5,6,7,8,9-hexamethyloctadecane |
|---|---|
| PubChem CID | 123746260 |
| Molecular Formula | C24H50 |
| Molecular Weight | 338.66 g/mol |
| Exact Mass | 338.39 |
| IUPAC Name | 4,5,6,7,8,9-hexamethyloctadecane |
| SMILES | CCCCCCCCCC(C)C(C)C(C)C(C)C(C)C(C)CCC |
| InChI | InChI=1S/C24H50/c1-9-11-12-13-14-15-16-18-20(4)22(6)24(8)23(7)21(5)19(3)17-10-2/h19-24H,9-18H2,1-8H3 |
| InChIKey | LPJKZASPTRANEV-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.66 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|