C16H34 — CID 21201053
3,4,5-trimethyltridecane (PubChem CID 21201053) has the molecular formula C16H34 and a molecular weight of 226.45 g/mol. Its IUPAC name is 3,4,5-trimethyltridecane.
| Compound Name | 3,4,5-trimethyltridecane |
|---|---|
| PubChem CID | 21201053 |
| Molecular Formula | C16H34 |
| Molecular Weight | 226.45 g/mol |
| Exact Mass | 226.27 |
| IUPAC Name | 3,4,5-trimethyltridecane |
| SMILES | CCCCCCCCC(C)C(C)C(C)CC |
| InChI | InChI=1S/C16H34/c1-6-8-9-10-11-12-13-15(4)16(5)14(3)7-2/h14-16H,6-13H2,1-5H3 |
| InChIKey | FKYJTJOGZLZTFZ-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.45 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|