C20H36 — CID 174304647
benzene;3,4,5-trimethylundecane (PubChem CID 174304647) has the molecular formula C20H36 and a molecular weight of 276.51 g/mol. Its IUPAC name is benzene;3,4,5-trimethylundecane.
| Compound Name | benzene;3,4,5-trimethylundecane |
|---|---|
| PubChem CID | 174304647 |
| Molecular Formula | C20H36 |
| Molecular Weight | 276.51 g/mol |
| Exact Mass | 276.28 |
| IUPAC Name | benzene;3,4,5-trimethylundecane |
| SMILES | CCCCCCC(C)C(C)C(C)CC.c1ccccc1 |
| InChI | InChI=1S/C14H30.C6H6/c1-6-8-9-10-11-13(4)14(5)12(3)7-2;1-2-4-6-5-3-1/h12-14H,6-11H2,1-5H3;1-6H |
| InChIKey | LMNXJZQLBRYRHZ-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.51 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|