C63H128 — CID 20659071
2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19,20,22,23,24,25,26,27,28,29,30,31,32-triacontamethyltritriacontane (PubChem CID 20659071) has the molecular formula C63H128 and a molecular weight of 885.72 g/mol. Its IUPAC name is 2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19,20,22,23,24,25,26,27,28,29,30,31,32-triacontamethyltritriacontane.
| Compound Name | 2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19,20,22,23,24,25,26,27,28,29,30,31,32-triacontamethyltritriacontane |
|---|---|
| PubChem CID | 20659071 |
| Molecular Formula | C63H128 |
| Molecular Weight | 885.72 g/mol |
| Exact Mass | 885.00 |
| IUPAC Name | 2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19,20,22,23,24,25,26,27,28,29,30,31,32-triacontamethyltritriacontane |
| SMILES | CC(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)CC(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C |
| InChI | InChI=1S/C63H128/c1-34(2)38(7)42(11)46(15)50(19)54(23)52(21)48(17)44(13)40(9)36(5)33-37(6)41(10)45(14)49(18)53(22)56(25)58(27)60(29)62(31)63(32)61(30)59(28)57(26)55(24)51(20)47(16)43(12)39(8)35(3)4/h34-63H,33H2,1-32H3 |
| InChIKey | XSMKPFFYDYPKMW-UHFFFAOYSA-N |
| XLogP | 20.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 30 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 885.72 |
| LogP ≤ 5 | 20.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |