About 2,6,10-trimethyldodecane
2,6,10-trimethyldodecane (PubChem CID 19773) has the molecular formula C15H32
and a molecular weight of 212.42 g/mol. Its IUPAC name is 2,6,10-trimethyldodecane.
Molecular Properties
| Compound Name | 2,6,10-trimethyldodecane |
| PubChem CID | 19773 |
| Molecular Formula | C15H32 |
| Molecular Weight | 212.42 g/mol |
| Exact Mass | 212.25 |
| IUPAC Name | 2,6,10-trimethyldodecane |
| SMILES | CCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C15H32/c1-6-14(4)10-8-12-15(5)11-7-9-13(2)3/h13-15H,6-12H2,1-5H3 |
| InChIKey | YFHFHLSMISYUAQ-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 212.42 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2,6,10-trimethyldodecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6,10-trimethyldodecane?
The IUPAC name of 2,6,10-trimethyldodecane (CID 19773) is 2,6,10-trimethyldodecane.
What is the SMILES notation for 2,6,10-trimethyldodecane?
The canonical SMILES for 2,6,10-trimethyldodecane is CCC(C)CCCC(C)CCCC(C)C.
What is the InChIKey of 2,6,10-trimethyldodecane?
The InChIKey is YFHFHLSMISYUAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H32/c1-6-14(4)10-8-12-15(5)11-7-9-13(2)3/h13-15H,6-12H2,1-5H3.
What are the key properties of 2,6,10-trimethyldodecane?
2,6,10-trimethyldodecane has a molecular weight of 212.42 g/mol, XLogP of 5.67, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6,10-trimethyldodecane is sourced from PubChem (CID 19773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).