About 2-methylpentadecane
2-methylpentadecane (PubChem CID 15267) has the molecular formula C16H34
and a molecular weight of 226.45 g/mol. Its IUPAC name is 2-methylpentadecane.
Molecular Properties
| Compound Name | 2-methylpentadecane |
| PubChem CID | 15267 |
| Molecular Formula | C16H34 |
| Molecular Weight | 226.45 g/mol |
| Exact Mass | 226.27 |
| IUPAC Name | 2-methylpentadecane |
| SMILES | CCCCCCCCCCCCCC(C)C |
| InChI | InChI=1S/C16H34/c1-4-5-6-7-8-9-10-11-12-13-14-15-16(2)3/h16H,4-15H2,1-3H3 |
| InChIKey | BANXPJUEBPWEOT-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 226.45 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpentadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpentadecane?
The IUPAC name of 2-methylpentadecane (CID 15267) is 2-methylpentadecane.
What is the SMILES notation for 2-methylpentadecane?
The canonical SMILES for 2-methylpentadecane is CCCCCCCCCCCCCC(C)C.
What is the InChIKey of 2-methylpentadecane?
The InChIKey is BANXPJUEBPWEOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H34/c1-4-5-6-7-8-9-10-11-12-13-14-15-16(2)3/h16H,4-15H2,1-3H3.
What are the key properties of 2-methylpentadecane?
2-methylpentadecane has a molecular weight of 226.45 g/mol, XLogP of 6.34, 12 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpentadecane is sourced from PubChem (CID 15267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).