C13H26 — CID 123741658
4-ethenyl-2,3,5-trimethyloctane (PubChem CID 123741658) has the molecular formula C13H26 and a molecular weight of 182.35 g/mol. Its IUPAC name is 4-ethenyl-2,3,5-trimethyloctane.
| Compound Name | 4-ethenyl-2,3,5-trimethyloctane |
|---|---|
| PubChem CID | 123741658 |
| Molecular Formula | C13H26 |
| Molecular Weight | 182.35 g/mol |
| Exact Mass | 182.20 |
| IUPAC Name | 4-ethenyl-2,3,5-trimethyloctane |
| SMILES | C=CC(C(C)CCC)C(C)C(C)C |
| InChI | InChI=1S/C13H26/c1-7-9-11(5)13(8-2)12(6)10(3)4/h8,10-13H,2,7,9H2,1,3-6H3 |
| InChIKey | HBEUFZHLGJUTMS-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.35 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|