C14H28 — CID 91411047
4-ethenyl-2,3,7-trimethylnonane (PubChem CID 91411047) has the molecular formula C14H28 and a molecular weight of 196.38 g/mol. Its IUPAC name is 4-ethenyl-2,3,7-trimethylnonane.
| Compound Name | 4-ethenyl-2,3,7-trimethylnonane |
|---|---|
| PubChem CID | 91411047 |
| Molecular Formula | C14H28 |
| Molecular Weight | 196.38 g/mol |
| Exact Mass | 196.22 |
| IUPAC Name | 4-ethenyl-2,3,7-trimethylnonane |
| SMILES | C=CC(CCC(C)CC)C(C)C(C)C |
| InChI | InChI=1S/C14H28/c1-7-12(5)9-10-14(8-2)13(6)11(3)4/h8,11-14H,2,7,9-10H2,1,3-6H3 |
| InChIKey | QJNKMCWBVNZMAZ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.38 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|