C11H22 — CID 90755259
4-ethenyl-3,5-dimethylheptane (PubChem CID 90755259) has the molecular formula C11H22 and a molecular weight of 154.30 g/mol. Its IUPAC name is 4-ethenyl-3,5-dimethylheptane.
| Compound Name | 4-ethenyl-3,5-dimethylheptane |
|---|---|
| PubChem CID | 90755259 |
| Molecular Formula | C11H22 |
| Molecular Weight | 154.30 g/mol |
| Exact Mass | 154.17 |
| IUPAC Name | 4-ethenyl-3,5-dimethylheptane |
| SMILES | C=CC(C(C)CC)C(C)CC |
| InChI | InChI=1S/C11H22/c1-6-9(4)11(8-3)10(5)7-2/h8-11H,3,6-7H2,1-2,4-5H3 |
| InChIKey | AKZZAODWERGIJP-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.30 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|