About 4-ethenyl-3,5-dimethylheptane
4-ethenyl-3,5-dimethylheptane (PubChem CID 90755259) has the molecular formula C11H22
and a molecular weight of 154.30 g/mol. Its IUPAC name is 4-ethenyl-3,5-dimethylheptane.
Molecular Properties
| Compound Name | 4-ethenyl-3,5-dimethylheptane |
| PubChem CID | 90755259 |
| Molecular Formula | C11H22 |
| Molecular Weight | 154.30 g/mol |
| Exact Mass | 154.17 |
| IUPAC Name | 4-ethenyl-3,5-dimethylheptane |
| SMILES | C=CC(C(C)CC)C(C)CC |
| InChI | InChI=1S/C11H22/c1-6-9(4)11(8-3)10(5)7-2/h8-11H,3,6-7H2,1-2,4-5H3 |
| InChIKey | AKZZAODWERGIJP-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.30 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-ethenyl-3,5-dimethylheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenyl-3,5-dimethylheptane?
The IUPAC name of 4-ethenyl-3,5-dimethylheptane (CID 90755259) is 4-ethenyl-3,5-dimethylheptane.
What is the SMILES notation for 4-ethenyl-3,5-dimethylheptane?
The canonical SMILES for 4-ethenyl-3,5-dimethylheptane is C=CC(C(C)CC)C(C)CC.
What is the InChIKey of 4-ethenyl-3,5-dimethylheptane?
The InChIKey is AKZZAODWERGIJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22/c1-6-9(4)11(8-3)10(5)7-2/h8-11H,3,6-7H2,1-2,4-5H3.
What are the key properties of 4-ethenyl-3,5-dimethylheptane?
4-ethenyl-3,5-dimethylheptane has a molecular weight of 154.30 g/mol, XLogP of 3.88, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenyl-3,5-dimethylheptane is sourced from PubChem (CID 90755259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).