About 2-ethenoxybutane
2-ethenoxybutane (PubChem CID 13172912) has the molecular formula C6H12O
and a molecular weight of 100.16 g/mol. Its IUPAC name is 2-ethenoxybutane.
Molecular Properties
| Compound Name | 2-ethenoxybutane |
| PubChem CID | 13172912 |
| Molecular Formula | C6H12O |
| Molecular Weight | 100.16 g/mol |
| Exact Mass | 100.09 |
| IUPAC Name | 2-ethenoxybutane |
| SMILES | C=COC(C)CC |
| InChI | InChI=1S/C6H12O/c1-4-6(3)7-5-2/h5-6H,2,4H2,1,3H3 |
| InChIKey | PIUJWWBOMGMSAY-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.16 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 2-ethenoxybutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenoxybutane?
The IUPAC name of 2-ethenoxybutane (CID 13172912) is 2-ethenoxybutane.
What is the SMILES notation for 2-ethenoxybutane?
The canonical SMILES for 2-ethenoxybutane is C=COC(C)CC.
What is the InChIKey of 2-ethenoxybutane?
The InChIKey is PIUJWWBOMGMSAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O/c1-4-6(3)7-5-2/h5-6H,2,4H2,1,3H3.
What are the key properties of 2-ethenoxybutane?
2-ethenoxybutane has a molecular weight of 100.16 g/mol, XLogP of 1.95, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenoxybutane is sourced from PubChem (CID 13172912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).