About azane;1-ethenoxypropan-1-amine
azane;1-ethenoxypropan-1-amine (PubChem CID 137499271) has the molecular formula C5H14N2O
and a molecular weight of 118.18 g/mol. Its IUPAC name is azane;1-ethenoxypropan-1-amine.
Molecular Properties
| Compound Name | azane;1-ethenoxypropan-1-amine |
| PubChem CID | 137499271 |
| Molecular Formula | C5H14N2O |
| Molecular Weight | 118.18 g/mol |
| Exact Mass | 118.11 |
| IUPAC Name | azane;1-ethenoxypropan-1-amine |
| SMILES | C=COC(N)CC.N |
| InChI | InChI=1S/C5H11NO.H3N/c1-3-5(6)7-4-2;/h4-5H,2-3,6H2,1H3;1H3 |
| InChIKey | JNVSPJCBPQSKKQ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.18 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze azane;1-ethenoxypropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1-ethenoxypropan-1-amine?
The IUPAC name of azane;1-ethenoxypropan-1-amine (CID 137499271) is azane;1-ethenoxypropan-1-amine.
What is the SMILES notation for azane;1-ethenoxypropan-1-amine?
The canonical SMILES for azane;1-ethenoxypropan-1-amine is C=COC(N)CC.N.
What is the InChIKey of azane;1-ethenoxypropan-1-amine?
The InChIKey is JNVSPJCBPQSKKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO.H3N/c1-3-5(6)7-4-2;/h4-5H,2-3,6H2,1H3;1H3.
What are the key properties of azane;1-ethenoxypropan-1-amine?
azane;1-ethenoxypropan-1-amine has a molecular weight of 118.18 g/mol, XLogP of 1.00, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1-ethenoxypropan-1-amine is sourced from PubChem (CID 137499271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).