About 2-ethenoxybutoxysilane
2-ethenoxybutoxysilane (PubChem CID 154147288) has the molecular formula C6H14O2Si
and a molecular weight of 146.26 g/mol. Its IUPAC name is 2-ethenoxybutoxysilane.
Molecular Properties
| Compound Name | 2-ethenoxybutoxysilane |
| PubChem CID | 154147288 |
| Molecular Formula | C6H14O2Si |
| Molecular Weight | 146.26 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | 2-ethenoxybutoxysilane |
| SMILES | C=COC(CC)CO[SiH3] |
| InChI | InChI=1S/C6H14O2Si/c1-3-6(5-8-9)7-4-2/h4,6H,2-3,5H2,1,9H3 |
| InChIKey | IHWSOKLALKRCBL-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.26 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-ethenoxybutoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenoxybutoxysilane?
The IUPAC name of 2-ethenoxybutoxysilane (CID 154147288) is 2-ethenoxybutoxysilane.
What is the SMILES notation for 2-ethenoxybutoxysilane?
The canonical SMILES for 2-ethenoxybutoxysilane is C=COC(CC)CO[SiH3].
What is the InChIKey of 2-ethenoxybutoxysilane?
The InChIKey is IHWSOKLALKRCBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O2Si/c1-3-6(5-8-9)7-4-2/h4,6H,2-3,5H2,1,9H3.
What are the key properties of 2-ethenoxybutoxysilane?
2-ethenoxybutoxysilane has a molecular weight of 146.26 g/mol, XLogP of 0.22, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenoxybutoxysilane is sourced from PubChem (CID 154147288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).