C9H18O3 — CID 174290240
4-ethenoxyheptane-2,6-diol (PubChem CID 174290240) has the molecular formula C9H18O3 and a molecular weight of 174.24 g/mol. Its IUPAC name is 4-ethenoxyheptane-2,6-diol.
| Compound Name | 4-ethenoxyheptane-2,6-diol |
|---|---|
| PubChem CID | 174290240 |
| Molecular Formula | C9H18O3 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.13 |
| IUPAC Name | 4-ethenoxyheptane-2,6-diol |
| SMILES | C=COC(CC(C)O)CC(C)O |
| InChI | InChI=1S/C9H18O3/c1-4-12-9(5-7(2)10)6-8(3)11/h4,7-11H,1,5-6H2,2-3H3 |
| InChIKey | YJXARAQPKRVZFN-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|