C9H14O3 — CID 139891834
ethyl 3-ethenoxy-2-methylidenebutanoate (PubChem CID 139891834) has the molecular formula C9H14O3 and a molecular weight of 170.21 g/mol. Its IUPAC name is ethyl 3-ethenoxy-2-methylidenebutanoate.
| Compound Name | ethyl 3-ethenoxy-2-methylidenebutanoate |
|---|---|
| PubChem CID | 139891834 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | ethyl 3-ethenoxy-2-methylidenebutanoate |
| SMILES | C=COC(C)C(=C)C(=O)OCC |
| InChI | InChI=1S/C9H14O3/c1-5-11-8(4)7(3)9(10)12-6-2/h5,8H,1,3,6H2,2,4H3 |
| InChIKey | MEGNMUIKIDPXJX-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|