C13H15IO4 — CID 101262982
ethyl 3-(3-hydroxy-2-iodophenoxy)-2-methylidenebutanoate (PubChem CID 101262982) has the molecular formula C13H15IO4 and a molecular weight of 362.16 g/mol. Its IUPAC name is ethyl 3-(3-hydroxy-2-iodophenoxy)-2-methylidenebutanoate.
| Compound Name | ethyl 3-(3-hydroxy-2-iodophenoxy)-2-methylidenebutanoate |
|---|---|
| PubChem CID | 101262982 |
| Molecular Formula | C13H15IO4 |
| Molecular Weight | 362.16 g/mol |
| Exact Mass | 362.00 |
| IUPAC Name | ethyl 3-(3-hydroxy-2-iodophenoxy)-2-methylidenebutanoate |
| SMILES | C=C(C(=O)OCC)C(C)Oc1cccc(O)c1I |
| InChI | InChI=1S/C13H15IO4/c1-4-17-13(16)8(2)9(3)18-11-7-5-6-10(15)12(11)14/h5-7,9,15H,2,4H2,1,3H3 |
| InChIKey | YXGWCHIBDVIXFO-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.16 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|