C18H20O5 — CID 11427072
ethyl (2R)-2-(4-hydroxy-5-prop-2-enoxynaphthalen-1-yl)oxypropanoate (PubChem CID 11427072) has the molecular formula C18H20O5 and a molecular weight of 316.35 g/mol. Its IUPAC name is ethyl (2R)-2-(4-hydroxy-5-prop-2-enoxynaphthalen-1-yl)oxypropanoate.
| Compound Name | ethyl (2R)-2-(4-hydroxy-5-prop-2-enoxynaphthalen-1-yl)oxypropanoate |
|---|---|
| PubChem CID | 11427072 |
| Molecular Formula | C18H20O5 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | ethyl (2R)-2-(4-hydroxy-5-prop-2-enoxynaphthalen-1-yl)oxypropanoate |
| SMILES | C=CCOc1cccc2c(O[C@H](C)C(=O)OCC)ccc(O)c12 |
| InChI | InChI=1S/C18H20O5/c1-4-11-22-16-8-6-7-13-15(10-9-14(19)17(13)16)23-12(3)18(20)21-5-2/h4,6-10,12,19H,1,5,11H2,2-3H3/t12-/m1/s1 |
| InChIKey | XSFWVFCKEDUBEN-GFCCVEGCSA-N |
| XLogP | 3.44 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|